CAS 1698849-40-9 appears in our catalog under these names: Cyclopropylmethyl 5-chloropyrazine-2-carboxylate, 98%, Cyclopropylmethyl 5-chloropyrazine-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Cyclopropylmethyl 5-chloropyrazine-2-carboxylate (CAS 1698849-40-9) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: cyclopropylmethyl 5-chloropyrazine-2-carboxylate. InChIKey: HJMSFAAVTNEKCC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | cyclopropylmethyl 5-chloropyrazine-2-carboxylate |
| InChIKey | HJMSFAAVTNEKCC-UHFFFAOYSA-N |
| SMILES | C1CC1COC(=O)C2=CN=C(C=N2)Cl |
Computed by PubChem (NCBI)