CAS 1698909-21-5 is the registry number for 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carbonitrile (CAS 1698909-21-5) is a chemical compound with the molecular formula C10H16BNO2 and a molecular weight of 193.05 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carbonitrile. InChIKey: LMBRSTBCFVYBJR-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2 |
|---|---|
| Molecular weight | 193.05 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carbonitrile |
| InChIKey | LMBRSTBCFVYBJR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC2C#N |
Computed by PubChem (NCBI)