Products 91011-76-6
CAS 91011-76-6 appears in our catalog under these names: 4-(Diethylamino)phenylboronic acid, 98%, 98%, (4-(Diethylamino)phenyl)boronic acid, 95%, 4-(Diethylamino)phenylboronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
[4-(diethylamino)phenyl]boronic acid (CAS 91011-76-6) is a chemical compound with the molecular formula C10H16BNO2 and a molecular weight of 193.05 g/mol. IUPAC name: [4-(diethylamino)phenyl]boronic acid. InChIKey: JEVVHTYCMAMSJL-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2 |
|---|---|
| Molecular weight | 193.05 g/mol |
| IUPAC name | [4-(diethylamino)phenyl]boronic acid |
| InChIKey | JEVVHTYCMAMSJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N(CC)CC)(O)O |
Computed by PubChem (NCBI)