CAS 2225170-94-3 is the registry number for 2–Methyl–6–(tert–butyl)pyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(6-tert-butyl-2-methyl-3-pyridinyl)boronic acid (CAS 2225170-94-3) is a chemical compound with the molecular formula C10H16BNO2 and a molecular weight of 193.05 g/mol. IUPAC name: (6-tert-butyl-2-methyl-3-pyridinyl)boronic acid. InChIKey: DSZMRFZTQKJWHH-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2 |
|---|---|
| Molecular weight | 193.05 g/mol |
| IUPAC name | (6-tert-butyl-2-methyl-3-pyridinyl)boronic acid |
| InChIKey | DSZMRFZTQKJWHH-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)