CAS 476004-79-2 appears in our catalog under these names: 2-Pinacolateborylpyrrole, 2–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)–1H–pyrrole, 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole, 98%. Offered by: TRC, GLPBio, AmBeed. Available pack sizes: 500mg, 100mg, 1g, 250mg, 5g.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole (CAS 476004-79-2) is a chemical compound with the molecular formula C10H16BNO2 and a molecular weight of 193.05 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole. InChIKey: YBJLMIJWFHVJQU-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO2 |
|---|---|
| Molecular weight | 193.05 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole |
| InChIKey | YBJLMIJWFHVJQU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CN2 |
Computed by PubChem (NCBI)