CAS 1699628-05-1 is the registry number for 6-Chloro-8-methylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1699628-05-1) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: ZUUONCYQBRICSF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | ZUUONCYQBRICSF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(C2)C(=O)O)Cl |
Computed by PubChem (NCBI)