CAS 856165-89-4 appears in our catalog under these names: 3–Chloro–4–(cyclopropylmethoxy)benzoic Acid, 3-Chloro-4-(cyclopropylmethoxy)benzoic acid, 95%, 3-Chloro-4-(cyclopropylmethoxy)benzoic Acid, 95+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3-chloro-4-(cyclopropylmethoxy)benzoic acid (CAS 856165-89-4) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 3-chloro-4-(cyclopropylmethoxy)benzoic acid. InChIKey: BLMUANMNUNBEJS-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 3-chloro-4-(cyclopropylmethoxy)benzoic acid |
| InChIKey | BLMUANMNUNBEJS-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)