CAS 84098-73-7 is the registry number for 4-(2-Chloropropionyl)phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(2-chloropropanoyl)phenyl]acetic acid (CAS 84098-73-7) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: 2-[4-(2-chloropropanoyl)phenyl]acetic acid. InChIKey: SYKQUPRADSJCQY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | 2-[4-(2-chloropropanoyl)phenyl]acetic acid |
| InChIKey | SYKQUPRADSJCQY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)CC(=O)O)Cl |
Computed by PubChem (NCBI)