CAS 131469-67-5 appears in our catalog under these names: 2-[(4-Chloro-phenyl)-hydroxy-methyl]-acrylic acid methyl ester, 95%, Methyl 2-((4-chlorophenyl)(hydroxy)methyl)acrylate, 95+%, 2–((4–CHLORO–PHENYL)–HYDROXY–METHYL)–ACRYLIC ACID METHYL ESTER. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 200mg.
Methyl 2-[(4-chlorophenyl)-hydroxymethyl]prop-2-enoate (CAS 131469-67-5) is a chemical compound with the molecular formula C11H11ClO3 and a molecular weight of 226.65 g/mol. IUPAC name: methyl 2-[(4-chlorophenyl)-hydroxymethyl]prop-2-enoate. InChIKey: GBKHNNKNMGBHSY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO3 |
|---|---|
| Molecular weight | 226.65 g/mol |
| IUPAC name | methyl 2-[(4-chlorophenyl)-hydroxymethyl]prop-2-enoate |
| InChIKey | GBKHNNKNMGBHSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C)C(C1=CC=C(C=C1)Cl)O |
Computed by PubChem (NCBI)