CAS 1700265-02-6 appears in our catalog under these names: 2,6-Difluoro-3,5-dimethoxybromobenzene, 95%, 3-Bromo-2,4-difluoro-1,5-dimethoxybenzene 97%, 3-Bromo-2,4-difluoro-1,5-dimethoxybenzene, 97%, 97%, 1-BROMO-2,6-DIFLUORO-3,5-DIMETHOXYBENZENE, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
3-bromo-2,4-difluoro-1,5-dimethoxybenzene (CAS 1700265-02-6) is a chemical compound with the molecular formula C8H7BrF2O2 and a molecular weight of 253.04 g/mol. IUPAC name: 3-bromo-2,4-difluoro-1,5-dimethoxybenzene. InChIKey: YEDAIBIZPKMFIH-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O2 |
|---|---|
| Molecular weight | 253.04 g/mol |
| IUPAC name | 3-bromo-2,4-difluoro-1,5-dimethoxybenzene |
| InChIKey | YEDAIBIZPKMFIH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1F)Br)F)OC |
Computed by PubChem (NCBI)