CAS 2271443-08-2 is the registry number for 5-Bromo-2,3-difluoro-4-ethoxyphenol, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-bromo-4-ethoxy-2,3-difluorophenol (CAS 2271443-08-2) is a chemical compound with the molecular formula C8H7BrF2O2 and a molecular weight of 253.04 g/mol. IUPAC name: 5-bromo-4-ethoxy-2,3-difluorophenol. InChIKey: PCAYJLHXTZNZJJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O2 |
|---|---|
| Molecular weight | 253.04 g/mol |
| IUPAC name | 5-bromo-4-ethoxy-2,3-difluorophenol |
| InChIKey | PCAYJLHXTZNZJJ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)F)O)Br |
Computed by PubChem (NCBI)