Products 2432848-66-1
CAS 2432848-66-1 is the registry number for 1-Bromo-3,4-difluoro-2,5-dimethoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-bromo-3,4-difluoro-2,5-dimethoxybenzene (CAS 2432848-66-1) is a chemical compound with the molecular formula C8H7BrF2O2 and a molecular weight of 253.04 g/mol. IUPAC name: 1-bromo-3,4-difluoro-2,5-dimethoxybenzene. InChIKey: PRPWVJIHFHNDGC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O2 |
|---|---|
| Molecular weight | 253.04 g/mol |
| IUPAC name | 1-bromo-3,4-difluoro-2,5-dimethoxybenzene |
| InChIKey | PRPWVJIHFHNDGC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1F)F)OC)Br |
Computed by PubChem (NCBI)