Products 1781546-49-3
CAS 1781546-49-3 appears in our catalog under these names: (5-Bromo-2,3-difluoro-4-methoxyphenyl)methanol, 95%, (5-Bromo-2,3-difluoro-4-methoxyphenyl)methanol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
(5-bromo-2,3-difluoro-4-methoxyphenyl)methanol (CAS 1781546-49-3) is a chemical compound with the molecular formula C8H7BrF2O2 and a molecular weight of 253.04 g/mol. IUPAC name: (5-bromo-2,3-difluoro-4-methoxyphenyl)methanol. InChIKey: FNBIYSWOXVYDIP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O2 |
|---|---|
| Molecular weight | 253.04 g/mol |
| IUPAC name | (5-bromo-2,3-difluoro-4-methoxyphenyl)methanol |
| InChIKey | FNBIYSWOXVYDIP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)F)CO)Br |
Computed by PubChem (NCBI)