Products 170080-13-4
CAS 170080-13-4 appears in our catalog under these names: H-D-Bip-OH, (R)-3-([1,1'-Biphenyl]-4-yl)-2-aminopropanoic acid, 98%, 98%, (R)-3-([1,1'-Biphenyl]-4-yl)-2-aminopropanoic acid, 98%. Offered by: Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
(2R)-2-amino-3-(4-phenylphenyl)propanoic acid (CAS 170080-13-4) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: (2R)-2-amino-3-(4-phenylphenyl)propanoic acid. InChIKey: JCZLABDVDPYLRZ-CQSZACIVSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-phenylphenyl)propanoic acid |
| InChIKey | JCZLABDVDPYLRZ-CQSZACIVSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(2R)-2-Amino-3-((1,1'-biphenyl)-4-yl)propanoic acid, (2R)-2-Amino-3-([1,1'-biphenyl]-4-yl)propanoic acid, (R)-3-([1,1'-Biphenyl]-4-yl)-2-aminopropanoic acid, D-4,4'-Biphenylalanine, (2R)-2-amino-3-(4-phenylphenyl)propanoic acid, D-BIPHENYLALANINE, [1,1'-Biphenyl]-4-propanoic acid, a-amino-, (R)-, 4-Phenyl-D-Phenylalanine, H-D-BIP-OH, 3-(4-Biphenylyl)-D-alanine