CAS 76985-08-5 appears in our catalog under these names: 2–Amino–3–(4–biphenylyl)propanoic Acid, 4-Phenyl-DL-phenylalanine, 95%, 95%, 3-([1,1'-Biphenyl]-4-yl)-2-aminopropanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g.
2-amino-3-(4-phenylphenyl)propanoic acid (CAS 76985-08-5) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-amino-3-(4-phenylphenyl)propanoic acid. InChIKey: JCZLABDVDPYLRZ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-amino-3-(4-phenylphenyl)propanoic acid |
| InChIKey | JCZLABDVDPYLRZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(C(=O)O)N |
Computed by PubChem (NCBI)