CAS 1701484-85-6 is the registry number for tert-Butyl (3aS,6aR)-4-oxohexahydrocyclopenta(c)pyrrole-2(1H)-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
Tert-butyl (3aS,6aR)-4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (CAS 1701484-85-6) is a chemical compound with the molecular formula C12H19NO3 and a molecular weight of 225.28 g/mol. IUPAC name: tert-butyl (3aS,6aR)-4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate. InChIKey: MZQZNAQWIOWKSR-DTWKUNHWSA-N.
| Molecular formula | C12H19NO3 |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | tert-butyl (3aS,6aR)-4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | MZQZNAQWIOWKSR-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CCC(=O)[C@@H]2C1 |
Computed by PubChem (NCBI)