CAS 1702493-96-6 is the registry number for Methyl 5-acetyl-2-methylthiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-acetyl-2-methyl-1,3-thiazole-4-carboxylate (CAS 1702493-96-6) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: methyl 5-acetyl-2-methyl-1,3-thiazole-4-carboxylate. InChIKey: MORKZLQDGRDNPW-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | methyl 5-acetyl-2-methyl-1,3-thiazole-4-carboxylate |
| InChIKey | MORKZLQDGRDNPW-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C(=O)C)C(=O)OC |
Computed by PubChem (NCBI)