CAS 1702698-94-9 appears in our catalog under these names: 3-Chloro-5-iodo-2-methylbenzoic acid, 3-Chloro-5-iodo-2-methylbenzoic acid 98%, 3-Chloro-5-iodo-2-methylbenzoic acid, 98%, 98%, 3-CHLORO-5-IODO-2-METHYLBENZOIC ACID, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
3-chloro-5-iodo-2-methylbenzoic acid (CAS 1702698-94-9) is a chemical compound with the molecular formula C8H6ClIO2 and a molecular weight of 296.49 g/mol. IUPAC name: 3-chloro-5-iodo-2-methylbenzoic acid. InChIKey: OPQJPHAKHSUPCS-UHFFFAOYSA-N.
| Molecular formula | C8H6ClIO2 |
|---|---|
| Molecular weight | 296.49 g/mol |
| IUPAC name | 3-chloro-5-iodo-2-methylbenzoic acid |
| InChIKey | OPQJPHAKHSUPCS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)I)C(=O)O |
Computed by PubChem (NCBI)