CAS 170287-67-9 is the registry number for 5-(2,3-Dihydro-indole-1-sulfonyl)-2-methoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoic acid (CAS 170287-67-9) is a chemical compound with the molecular formula C16H15NO5S and a molecular weight of 333.4 g/mol. IUPAC name: 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoic acid. InChIKey: QRJHADWFWDUEBC-UHFFFAOYSA-N.
| Molecular formula | C16H15NO5S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoic acid |
| InChIKey | QRJHADWFWDUEBC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)