Products 170287-67-9

CAS 170287-67-9 is the registry number for 5-(2,3-Dihydro-indole-1-sulfonyl)-2-methoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoic acid (CAS 170287-67-9) is a chemical compound with the molecular formula C16H15NO5S and a molecular weight of 333.4 g/mol. IUPAC name: 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoic acid. InChIKey: QRJHADWFWDUEBC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15NO5S
Molecular weight333.4 g/mol
IUPAC name5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoic acid
InChIKeyQRJHADWFWDUEBC-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)S(=O)(=O)N2CCC3=CC=CC=C32)C(=O)O

Computed by PubChem (NCBI)