Products 1858249-67-8

CAS 1858249-67-8 is the registry number for 4-(Benzylsulfonyl)-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid (CAS 1858249-67-8) is a chemical compound with the molecular formula C16H15NO5S and a molecular weight of 333.4 g/mol. IUPAC name: 4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid. InChIKey: QNWSKXNIGWQETG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15NO5S
Molecular weight333.4 g/mol
IUPAC name4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxylic acid
InChIKeyQNWSKXNIGWQETG-UHFFFAOYSA-N
SMILESC1C(OC2=CC=CC=C2N1S(=O)(=O)CC3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)