CAS 881777-26-0 is the registry number for N-benzo(3,4-d)1,3-dioxolen-5-yl-2-((4-methylphenyl)sulfonyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,3-benzodioxol-5-yl)-2-(4-methylphenyl)sulfonylacetamide (CAS 881777-26-0) is a chemical compound with the molecular formula C16H15NO5S and a molecular weight of 333.4 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-2-(4-methylphenyl)sulfonylacetamide. InChIKey: BLUXTDYCVVXFOB-UHFFFAOYSA-N.
| Molecular formula | C16H15NO5S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-2-(4-methylphenyl)sulfonylacetamide |
| InChIKey | BLUXTDYCVVXFOB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CC(=O)NC2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)