CAS 379729-41-6 appears in our catalog under these names: 3-[4-(4-Methoxy-phenylsulfamoyl)-phenyl]-acrylic acid, 95%, 3-{4-((4-methoxyphenyl)sulfamoyl)phenyl}prop-2-enoic acid, 95%, (2E)-3-{4-((4-Methoxyphenyl)sulfamoyl)phenyl}prop-2-enoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 50mg.
(E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid (CAS 379729-41-6) is a chemical compound with the molecular formula C16H15NO5S and a molecular weight of 333.4 g/mol. IUPAC name: (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid. InChIKey: UFDLWQHLUTYJMQ-NYYWCZLTSA-N.
| Molecular formula | C16H15NO5S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | (E)-3-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| InChIKey | UFDLWQHLUTYJMQ-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)