CAS 1704063-90-0 is the registry number for 4–Fluoro–3–((4–methylpiperidin–1–yl)methyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-fluoro-3-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid (CAS 1704063-90-0) is a chemical compound with the molecular formula C13H19BFNO2 and a molecular weight of 251.11 g/mol. IUPAC name: [4-fluoro-3-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid. InChIKey: QAKQIFKSHLOVAB-UHFFFAOYSA-N.
| Molecular formula | C13H19BFNO2 |
|---|---|
| Molecular weight | 251.11 g/mol |
| IUPAC name | [4-fluoro-3-[(4-methylpiperidin-1-yl)methyl]phenyl]boronic acid |
| InChIKey | QAKQIFKSHLOVAB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)CN2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)