CAS 1704097-20-0 is the registry number for (3–(N–(tert–Butyl)sulfamoyl)– 4–methylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid (CAS 1704097-20-0) is a chemical compound with the molecular formula C11H18BNO4S and a molecular weight of 271.15 g/mol. IUPAC name: [3-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid. InChIKey: QHFIHPWYTDWALC-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO4S |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | [3-(tert-butylsulfamoyl)-4-methylphenyl]boronic acid |
| InChIKey | QHFIHPWYTDWALC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)S(=O)(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)