CAS 2246845-30-5 appears in our catalog under these names: (4-(Butylsulfonamidomethyl)phenyl)boronic acid, 95%, (4–(butylsulfonamidomethyl)phenyl)boronic acid, (4-(butylsulfonamidomethyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 50mg.
[4-[(butylsulfonylamino)methyl]phenyl]boronic acid (CAS 2246845-30-5) is a chemical compound with the molecular formula C11H18BNO4S and a molecular weight of 271.15 g/mol. IUPAC name: [4-[(butylsulfonylamino)methyl]phenyl]boronic acid. InChIKey: ORCZPEPUSUKGSV-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO4S |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | [4-[(butylsulfonylamino)methyl]phenyl]boronic acid |
| InChIKey | ORCZPEPUSUKGSV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNS(=O)(=O)CCCC)(O)O |
Computed by PubChem (NCBI)