CAS 1704121-72-1 appears in our catalog under these names: (4-(N-Isopropylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, (4–(N–Isopropylsulfamoyl)–3,5 –dimethylphenyl)boronic acid, (4-(N-isopropylsulfamoyl)-3,5-dimethylphenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 500mg.
[3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid (CAS 1704121-72-1) is a chemical compound with the molecular formula C11H18BNO4S and a molecular weight of 271.15 g/mol. IUPAC name: [3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid. InChIKey: FMJRLYQOGPUFJU-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO4S |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | [3,5-dimethyl-4-(propan-2-ylsulfamoyl)phenyl]boronic acid |
| InChIKey | FMJRLYQOGPUFJU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)NC(C)C)C)(O)O |
Computed by PubChem (NCBI)