CAS 2377606-59-0 appears in our catalog under these names: [4-(tert-butylsulfamoyl)-3-methylphenyl]boronic acid, 98%, (4-(tert-Butylsulfamoyl)-3-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
[4-(tert-butylsulfamoyl)-3-methylphenyl]boronic acid (CAS 2377606-59-0) is a chemical compound with the molecular formula C11H18BNO4S and a molecular weight of 271.15 g/mol. IUPAC name: [4-(tert-butylsulfamoyl)-3-methylphenyl]boronic acid. InChIKey: TXOQPYCBHVEMGE-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO4S |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | [4-(tert-butylsulfamoyl)-3-methylphenyl]boronic acid |
| InChIKey | TXOQPYCBHVEMGE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)NC(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)