CAS 1704097-26-6 is the registry number for (4–(N–(tert–Butyl)sulfamoyl)– 2–fluorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-(tert-butylsulfamoyl)-2-fluorophenyl]boronic acid (CAS 1704097-26-6) is a chemical compound with the molecular formula C10H15BFNO4S and a molecular weight of 275.11 g/mol. IUPAC name: [4-(tert-butylsulfamoyl)-2-fluorophenyl]boronic acid. InChIKey: AUYXGYBQPAVGFM-UHFFFAOYSA-N.
| Molecular formula | C10H15BFNO4S |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | [4-(tert-butylsulfamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | AUYXGYBQPAVGFM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)S(=O)(=O)NC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)