CAS 1704121-79-8 is the registry number for (5–(N,N–Diethylsulfamoyl)–2 –fluorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[5-(diethylsulfamoyl)-2-fluorophenyl]boronic acid (CAS 1704121-79-8) is a chemical compound with the molecular formula C10H15BFNO4S and a molecular weight of 275.11 g/mol. IUPAC name: [5-(diethylsulfamoyl)-2-fluorophenyl]boronic acid. InChIKey: RBYWNDSBBYYNDT-UHFFFAOYSA-N.
| Molecular formula | C10H15BFNO4S |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | [5-(diethylsulfamoyl)-2-fluorophenyl]boronic acid |
| InChIKey | RBYWNDSBBYYNDT-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N(CC)CC)F)(O)O |
Computed by PubChem (NCBI)