CAS 170454-20-3 appears in our catalog under these names: 2–amino–3–methyl–3–nitrobutanoic acid, 3-Nitro-valine, 95%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
(2S)-2-amino-3-methyl-3-nitrobutanoic acid (CAS 170454-20-3) is a chemical compound with the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. IUPAC name: (2S)-2-amino-3-methyl-3-nitrobutanoic acid. InChIKey: SVQLBNMIYIBLOU-GSVOUGTGSA-N.
| Molecular formula | C5H10N2O4 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-3-nitrobutanoic acid |
| InChIKey | SVQLBNMIYIBLOU-GSVOUGTGSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)