Products 56614-12-1
CAS 56614-12-1 appears in our catalog under these names: (2R)–2–amino–4–(hydroxycarbamoyl)butanoic acid, (2R)-2-amino-4-(hydroxycarbamoyl)butanoic acid, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 50mg.
(2R)-2-amino-5-(hydroxyamino)-5-oxopentanoic acid (CAS 56614-12-1) is a chemical compound with the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. IUPAC name: (2R)-2-amino-5-(hydroxyamino)-5-oxopentanoic acid. InChIKey: YVGZXTQJQNXIAU-GSVOUGTGSA-N.
| Molecular formula | C5H10N2O4 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (2R)-2-amino-5-(hydroxyamino)-5-oxopentanoic acid |
| InChIKey | YVGZXTQJQNXIAU-GSVOUGTGSA-N |
| SMILES | C(CC(=O)NO)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)