Products 805179-13-9

CAS 805179-13-9 is the registry number for (S)-5-Amino-2-(hydroxyamino)-5-oxopentanoic acid 97%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(2S)-5-amino-2-(hydroxyamino)-5-oxopentanoic acid (CAS 805179-13-9) is a chemical compound with the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. IUPAC name: (2S)-5-amino-2-(hydroxyamino)-5-oxopentanoic acid. InChIKey: VQINCDSXSZLRHY-VKHMYHEASA-N.

Identity
Molecular formulaC5H10N2O4
Molecular weight162.14 g/mol
IUPAC name(2S)-5-amino-2-(hydroxyamino)-5-oxopentanoic acid
InChIKeyVQINCDSXSZLRHY-VKHMYHEASA-N
SMILESC(CC(=O)N)[C@@H](C(=O)O)NO

Computed by PubChem (NCBI)