CAS 805179-13-9 is the registry number for (S)-5-Amino-2-(hydroxyamino)-5-oxopentanoic acid 97%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
(2S)-5-amino-2-(hydroxyamino)-5-oxopentanoic acid (CAS 805179-13-9) is a chemical compound with the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. IUPAC name: (2S)-5-amino-2-(hydroxyamino)-5-oxopentanoic acid. InChIKey: VQINCDSXSZLRHY-VKHMYHEASA-N.
| Molecular formula | C5H10N2O4 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (2S)-5-amino-2-(hydroxyamino)-5-oxopentanoic acid |
| InChIKey | VQINCDSXSZLRHY-VKHMYHEASA-N |
| SMILES | C(CC(=O)N)[C@@H](C(=O)O)NO |
Computed by PubChem (NCBI)