Products 2190-78-5

CAS 2190-78-5 is the registry number for 2,5-diamino-3-hydroxy-5-oxopentanoic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,5-diamino-3-hydroxy-5-oxopentanoic acid (CAS 2190-78-5) is a chemical compound with the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. IUPAC name: 2,5-diamino-3-hydroxy-5-oxopentanoic acid. InChIKey: JNFVXFXEIGUSBZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10N2O4
Molecular weight162.14 g/mol
IUPAC name2,5-diamino-3-hydroxy-5-oxopentanoic acid
InChIKeyJNFVXFXEIGUSBZ-UHFFFAOYSA-N
SMILESC(C(C(C(=O)O)N)O)C(=O)N

Computed by PubChem (NCBI)