Products 170621-89-3

CAS 170621-89-3 is the registry number for 3,6-Dimethoxypicolinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3,6-dimethoxypyridine-2-carboxylic acid (CAS 170621-89-3) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 3,6-dimethoxypyridine-2-carboxylic acid. InChIKey: QFKQRRSTFZHRJC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9NO4
Molecular weight183.16 g/mol
IUPAC name3,6-dimethoxypyridine-2-carboxylic acid
InChIKeyQFKQRRSTFZHRJC-UHFFFAOYSA-N
SMILESCOC1=C(N=C(C=C1)OC)C(=O)O

Computed by PubChem (NCBI)