CAS 170621-89-3 is the registry number for 3,6-Dimethoxypicolinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3,6-dimethoxypyridine-2-carboxylic acid (CAS 170621-89-3) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 3,6-dimethoxypyridine-2-carboxylic acid. InChIKey: QFKQRRSTFZHRJC-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 3,6-dimethoxypyridine-2-carboxylic acid |
| InChIKey | QFKQRRSTFZHRJC-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)