CAS 1706461-02-0 is the registry number for 7-Methoxy-1H,2H,3H,4H-cyclopenta(b)indol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine (CAS 1706461-02-0) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine. InChIKey: CDQWCODTCBODIH-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 7-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indol-2-amine |
| InChIKey | CDQWCODTCBODIH-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC3=C2CC(C3)N |
Computed by PubChem (NCBI)