Products 1707290-41-2
CAS 1707290-41-2 is the registry number for tert-butyl N-[(4R,5R)-5-amino-2,2-dimethyl-tetrahydropyran-4-yl]carbamate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(4R,5R)-5-amino-2,2-dimethyloxan-4-yl]carbamate (CAS 1707290-41-2) is a chemical compound with the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. IUPAC name: tert-butyl N-[(4R,5R)-5-amino-2,2-dimethyloxan-4-yl]carbamate. InChIKey: SJKAIFPGQUEKLD-DTWKUNHWSA-N.
| Molecular formula | C12H24N2O3 |
|---|---|
| Molecular weight | 244.33 g/mol |
| IUPAC name | tert-butyl N-[(4R,5R)-5-amino-2,2-dimethyloxan-4-yl]carbamate |
| InChIKey | SJKAIFPGQUEKLD-DTWKUNHWSA-N |
| SMILES | CC1(C[C@H]([C@H](CO1)N)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)