CAS 1707358-66-4 is the registry number for 2–Methyl–1,3,8–triazaspiro(4·5)dec–1–en–4–one hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrochloride (CAS 1707358-66-4) is a chemical compound with the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. IUPAC name: 2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrochloride. InChIKey: INSODZKNAJJGCM-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;hydrochloride |
| InChIKey | INSODZKNAJJGCM-UHFFFAOYSA-N |
| SMILES | CC1=NC2(CCNCC2)C(=O)N1.Cl |
Computed by PubChem (NCBI)