Products 1708008-24-5
CAS 1708008-24-5 is the registry number for Methyl 5-((3-chlorophenyl)methyl)-1,3,4-oxadiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazole-2-carboxylate (CAS 1708008-24-5) is a chemical compound with the molecular formula C11H9ClN2O3 and a molecular weight of 252.65 g/mol. IUPAC name: methyl 5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazole-2-carboxylate. InChIKey: ZFJJXBCGFSLGEQ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O3 |
|---|---|
| Molecular weight | 252.65 g/mol |
| IUPAC name | methyl 5-[(3-chlorophenyl)methyl]-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | ZFJJXBCGFSLGEQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN=C(O1)CC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)