Products 1708079-62-2
CAS 1708079-62-2 is the registry number for tert-Butyl 6-amino-7-cyano-2,3-dihydro-1h-pyrrolizine-5-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 2-amino-1-cyano-6,7-dihydro-5H-pyrrolizine-3-carboxylate (CAS 1708079-62-2) is a chemical compound with the molecular formula C13H17N3O2 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl 2-amino-1-cyano-6,7-dihydro-5H-pyrrolizine-3-carboxylate. InChIKey: VAUBLRPKJGIVBW-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl 2-amino-1-cyano-6,7-dihydro-5H-pyrrolizine-3-carboxylate |
| InChIKey | VAUBLRPKJGIVBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=C2N1CCC2)C#N)N |
Computed by PubChem (NCBI)