CAS 900514-09-2 is the registry number for (1H-Pyrrolo[2,3-b]pyridin-5-ylmethyl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)carbamate (CAS 900514-09-2) is a chemical compound with the molecular formula C13H17N3O2 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)carbamate. InChIKey: XIDJEMPYAHCGHE-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-5-ylmethyl)carbamate |
| InChIKey | XIDJEMPYAHCGHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CN=C2C(=C1)C=CN2 |
Computed by PubChem (NCBI)