CAS 1845716-98-4 is the registry number for Ethyl 1-tert-butyl-1,2,3-benzotriazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 1-tert-butylbenzotriazole-5-carboxylate (CAS 1845716-98-4) is a chemical compound with the molecular formula C13H17N3O2 and a molecular weight of 247.29 g/mol. IUPAC name: ethyl 1-tert-butylbenzotriazole-5-carboxylate. InChIKey: JFMOEUKEHQFDOR-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | ethyl 1-tert-butylbenzotriazole-5-carboxylate |
| InChIKey | JFMOEUKEHQFDOR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(N=N2)C(C)(C)C |
Computed by PubChem (NCBI)