CAS 1993813-55-0 is the registry number for 1-(4-Ethylphenyl)-n'-hydroxy-5-oxopyrrolidine-3-carboximidamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(4-ethylphenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide (CAS 1993813-55-0) is a chemical compound with the molecular formula C13H17N3O2 and a molecular weight of 247.29 g/mol. IUPAC name: 1-(4-ethylphenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide. InChIKey: ZMCWMQJZTWZLEV-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-N'-hydroxy-5-oxopyrrolidine-3-carboximidamide |
| InChIKey | ZMCWMQJZTWZLEV-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)N2CC(CC2=O)/C(=N/O)/N |
Computed by PubChem (NCBI)