Products 1708103-69-8
CAS 1708103-69-8 is the registry number for ARTD10/PARP10-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-N'-(3-carbamoylphenyl)-N-methylbut-2-enediamide (CAS 1708103-69-8) is a chemical compound with the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. IUPAC name: (Z)-N'-(3-carbamoylphenyl)-N-methylbut-2-enediamide. InChIKey: FYQRBLGGKLIYRQ-WAYWQWQTSA-N.
| Molecular formula | C12H13N3O3 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (Z)-N'-(3-carbamoylphenyl)-N-methylbut-2-enediamide |
| InChIKey | FYQRBLGGKLIYRQ-WAYWQWQTSA-N |
| SMILES | CNC(=O)/C=C\C(=O)NC1=CC=CC(=C1)C(=O)N |
Computed by PubChem (NCBI)