Products 17122-33-7
CAS 17122-33-7 is the registry number for Lidocaine Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-dichloro-N-(2,4-dimethylphenyl)acetamide (CAS 17122-33-7) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 2,2-dichloro-N-(2,4-dimethylphenyl)acetamide. InChIKey: NGDHPRNJFMJLSM-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 2,2-dichloro-N-(2,4-dimethylphenyl)acetamide |
| InChIKey | NGDHPRNJFMJLSM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C(Cl)Cl)C |
Computed by PubChem (NCBI)