CAS 17136-26-4 appears in our catalog under these names: H-β-Ala-Val-OH, H-beta-Ala-Val-OH. Offered by: Creative Peptides, Biosynth. Available pack sizes: on request, 5000mg, 2000mg, 10000mg.
(2S)-2-(3-aminopropanoylamino)-3-methylbutanoic acid (CAS 17136-26-4) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-3-methylbutanoic acid. InChIKey: DVIZUEAPVZZYCO-ZETCQYMHSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-3-methylbutanoic acid |
| InChIKey | DVIZUEAPVZZYCO-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)