Products 1713713-74-6
CAS 1713713-74-6 appears in our catalog under these names: 1-(2-Chloropyridin-3-yl)-2,2,2-trifluoroethanol, 95%, 1-(2-Chloropyridin-3-yl)-2,2,2-trifluoroethan-1-ol, 1-(2-Chloropyridin-3-yl)-2,2,2-trifluoroethanol, ≥95%, ≥95%, 1-(2-Chloropyridin-3-yl)-2,2,2-trifluoroethanol, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethanol (CAS 1713713-74-6) is a chemical compound with the molecular formula C7H5ClF3NO and a molecular weight of 211.57 g/mol. IUPAC name: 1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: DSUDBVZEAJNLKH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF3NO |
|---|---|
| Molecular weight | 211.57 g/mol |
| IUPAC name | 1-(2-chloro-3-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | DSUDBVZEAJNLKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C(C(F)(F)F)O |
Computed by PubChem (NCBI)