Products 1714979-64-2
CAS 1714979-64-2 is the registry number for tert-butyl 3-(4-chlorophenyl)azetidine-1-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(4-chlorophenyl)azetidine-1-carboxylate (CAS 1714979-64-2) is a chemical compound with the molecular formula C14H18ClNO2 and a molecular weight of 267.75 g/mol. IUPAC name: tert-butyl 3-(4-chlorophenyl)azetidine-1-carboxylate. InChIKey: PMHPTXJQUBESIW-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO2 |
|---|---|
| Molecular weight | 267.75 g/mol |
| IUPAC name | tert-butyl 3-(4-chlorophenyl)azetidine-1-carboxylate |
| InChIKey | PMHPTXJQUBESIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)