Products 171569-37-2

CAS 171569-37-2 is the registry number for Clomazone metabolite FMC 65317. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 25mg, 1x25mg.

Structural formula: {0} (CAS {1})

N-[(2-chlorophenyl)methyl]-3-hydroxy-2,2-dimethylpropanamide (CAS 171569-37-2) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: N-[(2-chlorophenyl)methyl]-3-hydroxy-2,2-dimethylpropanamide. InChIKey: TWJXCDFCKPEPHD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClNO2
Molecular weight241.71 g/mol
IUPAC nameN-[(2-chlorophenyl)methyl]-3-hydroxy-2,2-dimethylpropanamide
InChIKeyTWJXCDFCKPEPHD-UHFFFAOYSA-N
SMILESCC(C)(CO)C(=O)NCC1=CC=CC=C1Cl

Computed by PubChem (NCBI)