CAS 1715913-00-0 is the registry number for 4-Chloro-5-fluoro-1H-indazol-3-amine, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 1g, 5g.
4-chloro-5-fluoro-1H-indazol-3-amine (CAS 1715913-00-0) is a chemical compound with the molecular formula C7H5ClFN3 and a molecular weight of 185.58 g/mol. IUPAC name: 4-chloro-5-fluoro-1H-indazol-3-amine. InChIKey: NIVIOGYLIZMNSR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFN3 |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 4-chloro-5-fluoro-1H-indazol-3-amine |
| InChIKey | NIVIOGYLIZMNSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2N)Cl)F |
Computed by PubChem (NCBI)