CAS 2769821-40-9 is the registry number for 4-Chloro-7-fluoro-5-methylpyrrolo[2,1-f][1,2,4]triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-7-fluoro-5-methylpyrrolo[2,1-f][1,2,4]triazine (CAS 2769821-40-9) is a chemical compound with the molecular formula C7H5ClFN3 and a molecular weight of 185.58 g/mol. IUPAC name: 4-chloro-7-fluoro-5-methylpyrrolo[2,1-f][1,2,4]triazine. InChIKey: DNJMPZFEXXUZII-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFN3 |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 4-chloro-7-fluoro-5-methylpyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | DNJMPZFEXXUZII-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=NN2C(=C1)F)Cl |
Computed by PubChem (NCBI)